C8H8F3N3O3 — CID 119009677
2-amino-4-(aminomethyl)-6-(trifluoromethoxy)pyridine-3-carboxylic acid (PubChem CID 119009677) has the molecular formula C8H8F3N3O3 and a molecular weight of 251.16 g/mol. Its IUPAC name is 2-amino-4-(aminomethyl)-6-(trifluoromethoxy)pyridine-3-carboxylic acid.
| Compound Name | 2-amino-4-(aminomethyl)-6-(trifluoromethoxy)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 119009677 |
| Molecular Formula | C8H8F3N3O3 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-amino-4-(aminomethyl)-6-(trifluoromethoxy)pyridine-3-carboxylic acid |
| SMILES | NCc1cc(OC(F)(F)F)nc(N)c1C(=O)O |
| InChI | InChI=1S/C8H8F3N3O3/c9-8(10,11)17-4-1-3(2-12)5(7(15)16)6(13)14-4/h1H,2,12H2,(H2,13,14)(H,15,16) |
| InChIKey | JFMDPQUUIFSHQU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |