C10H8F6N2O3 — CID 134672737
methyl 4-(aminomethyl)-6-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 134672737) has the molecular formula C10H8F6N2O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is methyl 4-(aminomethyl)-6-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-(aminomethyl)-6-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134672737 |
| Molecular Formula | C10H8F6N2O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | methyl 4-(aminomethyl)-6-(trifluoromethoxy)-3-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(OC(F)(F)F)cc(CN)c1C(F)(F)F |
| InChI | InChI=1S/C10H8F6N2O3/c1-20-8(19)7-6(9(11,12)13)4(3-17)2-5(18-7)21-10(14,15)16/h2H,3,17H2,1H3 |
| InChIKey | VLHUGZVREOBSIN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |