C8H5F6IN2O — CID 134666814
[6-iodo-3-(trifluoromethoxy)-2-(trifluoromethyl)-4-pyridinyl]methanamine (PubChem CID 134666814) has the molecular formula C8H5F6IN2O and a molecular weight of 386.03 g/mol. Its IUPAC name is [6-iodo-3-(trifluoromethoxy)-2-(trifluoromethyl)-4-pyridinyl]methanamine.
| Compound Name | [6-iodo-3-(trifluoromethoxy)-2-(trifluoromethyl)-4-pyridinyl]methanamine |
|---|---|
| PubChem CID | 134666814 |
| Molecular Formula | C8H5F6IN2O |
| Molecular Weight | 386.03 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | [6-iodo-3-(trifluoromethoxy)-2-(trifluoromethyl)-4-pyridinyl]methanamine |
| SMILES | NCc1cc(I)nc(C(F)(F)F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H5F6IN2O/c9-7(10,11)6-5(18-8(12,13)14)3(2-16)1-4(15)17-6/h1H,2,16H2 |
| InChIKey | BBFIZGZGFCRWBC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.03 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|