C11H12F3IN2O3 — CID 134681233
ethyl 2-[4-(aminomethyl)-6-iodo-3-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134681233) has the molecular formula C11H12F3IN2O3 and a molecular weight of 404.13 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)-6-iodo-3-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-(aminomethyl)-6-iodo-3-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134681233 |
| Molecular Formula | C11H12F3IN2O3 |
| Molecular Weight | 404.13 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)-6-iodo-3-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(I)cc(CN)c1OC(F)(F)F |
| InChI | InChI=1S/C11H12F3IN2O3/c1-2-19-9(18)4-7-10(20-11(12,13)14)6(5-16)3-8(15)17-7/h3H,2,4-5,16H2,1H3 |
| InChIKey | CKLNUTGUSCIKTJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.13 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|