C11H14F3N3O3 — CID 133086121
ethyl 2-[6-amino-2-(aminomethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 133086121) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is ethyl 2-[6-amino-2-(aminomethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-amino-2-(aminomethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133086121 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | ethyl 2-[6-amino-2-(aminomethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC(F)(F)F)c(N)nc1CN |
| InChI | InChI=1S/C11H14F3N3O3/c1-2-19-9(18)4-6-3-8(20-11(12,13)14)10(16)17-7(6)5-15/h3H,2,4-5,15H2,1H3,(H2,16,17) |
| InChIKey | QRRAPZGMEPOWQI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |