C12H13F5N2O3 — CID 134668999
ethyl 2-[3-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134668999) has the molecular formula C12H13F5N2O3 and a molecular weight of 328.24 g/mol. Its IUPAC name is ethyl 2-[3-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134668999 |
| Molecular Formula | C12H13F5N2O3 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | ethyl 2-[3-(aminomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(C(F)F)c(OC(F)(F)F)cc1CN |
| InChI | InChI=1S/C12H13F5N2O3/c1-2-21-9(20)4-7-6(5-18)3-8(22-12(15,16)17)10(19-7)11(13)14/h3,11H,2,4-5,18H2,1H3 |
| InChIKey | RTEQZAGBPWFFMP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |