C11H9BrF5NO3 — CID 134668956
methyl 2-[2-(bromomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134668956) has the molecular formula C11H9BrF5NO3 and a molecular weight of 378.09 g/mol. Its IUPAC name is methyl 2-[2-(bromomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[2-(bromomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134668956 |
| Molecular Formula | C11H9BrF5NO3 |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | methyl 2-[2-(bromomethyl)-6-(difluoromethyl)-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(OC(F)(F)F)c(C(F)F)nc1CBr |
| InChI | InChI=1S/C11H9BrF5NO3/c1-20-8(19)3-5-2-7(21-11(15,16)17)9(10(13)14)18-6(5)4-12/h2,10H,3-4H2,1H3 |
| InChIKey | CDIYHTXRVTXFFJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|