C11H10F5NO4 — CID 134681746
methyl 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134681746) has the molecular formula C11H10F5NO4 and a molecular weight of 315.19 g/mol. Its IUPAC name is methyl 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | methyl 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134681746 |
| Molecular Formula | C11H10F5NO4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 2-[2-(difluoromethyl)-6-methoxy-5-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(OC(F)(F)F)c(OC)nc1C(F)F |
| InChI | InChI=1S/C11H10F5NO4/c1-19-7(18)4-5-3-6(21-11(14,15)16)10(20-2)17-8(5)9(12)13/h3,9H,4H2,1-2H3 |
| InChIKey | DAIYJFOBDSYHOZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |