C11H12ClF2NO3 — CID 133099114
methyl 2-[5-(chloromethyl)-6-(difluoromethyl)-2-methoxy-3-pyridinyl]acetate (PubChem CID 133099114) has the molecular formula C11H12ClF2NO3 and a molecular weight of 279.67 g/mol. Its IUPAC name is methyl 2-[5-(chloromethyl)-6-(difluoromethyl)-2-methoxy-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-(chloromethyl)-6-(difluoromethyl)-2-methoxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133099114 |
| Molecular Formula | C11H12ClF2NO3 |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | methyl 2-[5-(chloromethyl)-6-(difluoromethyl)-2-methoxy-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(CCl)c(C(F)F)nc1OC |
| InChI | InChI=1S/C11H12ClF2NO3/c1-17-8(16)4-6-3-7(5-12)9(10(13)14)15-11(6)18-2/h3,10H,4-5H2,1-2H3 |
| InChIKey | NVHQSQMBDRZZKO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|