C12H16F2N2O3 — CID 133085326
ethyl 2-[6-(aminomethyl)-2-(difluoromethyl)-5-methoxy-3-pyridinyl]acetate (PubChem CID 133085326) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is ethyl 2-[6-(aminomethyl)-2-(difluoromethyl)-5-methoxy-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-(aminomethyl)-2-(difluoromethyl)-5-methoxy-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133085326 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl 2-[6-(aminomethyl)-2-(difluoromethyl)-5-methoxy-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC)c(CN)nc1C(F)F |
| InChI | InChI=1S/C12H16F2N2O3/c1-3-19-10(17)5-7-4-9(18-2)8(6-15)16-11(7)12(13)14/h4,12H,3,5-6,15H2,1-2H3 |
| InChIKey | CKWGHDXNXMKDCN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |