C11H15F2N3O2 — CID 134664484
ethyl 2-[6-amino-5-(aminomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate (PubChem CID 134664484) has the molecular formula C11H15F2N3O2 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl 2-[6-amino-5-(aminomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-amino-5-(aminomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134664484 |
| Molecular Formula | C11H15F2N3O2 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | ethyl 2-[6-amino-5-(aminomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CN)c(N)nc1C(F)F |
| InChI | InChI=1S/C11H15F2N3O2/c1-2-18-8(17)4-6-3-7(5-14)11(15)16-9(6)10(12)13/h3,10H,2,4-5,14H2,1H3,(H2,15,16) |
| InChIKey | ZUCDAPMVZVFHRC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |