C11H12F2INO2 — CID 133101161
ethyl 2-[2-(difluoromethyl)-3-iodo-6-methyl-4-pyridinyl]acetate (PubChem CID 133101161) has the molecular formula C11H12F2INO2 and a molecular weight of 355.12 g/mol. Its IUPAC name is ethyl 2-[2-(difluoromethyl)-3-iodo-6-methyl-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-(difluoromethyl)-3-iodo-6-methyl-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 133101161 |
| Molecular Formula | C11H12F2INO2 |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | ethyl 2-[2-(difluoromethyl)-3-iodo-6-methyl-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C)nc(C(F)F)c1I |
| InChI | InChI=1S/C11H12F2INO2/c1-3-17-8(16)5-7-4-6(2)15-10(9(7)14)11(12)13/h4,11H,3,5H2,1-2H3 |
| InChIKey | UQGQYWJTWRQVAI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|