C11H13BrF2N2O2 — CID 134674485
ethyl 2-[6-amino-5-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate (PubChem CID 134674485) has the molecular formula C11H13BrF2N2O2 and a molecular weight of 323.14 g/mol. Its IUPAC name is ethyl 2-[6-amino-5-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[6-amino-5-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134674485 |
| Molecular Formula | C11H13BrF2N2O2 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | ethyl 2-[6-amino-5-(bromomethyl)-2-(difluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CBr)c(N)nc1C(F)F |
| InChI | InChI=1S/C11H13BrF2N2O2/c1-2-18-8(17)4-6-3-7(5-12)11(15)16-9(6)10(13)14/h3,10H,2,4-5H2,1H3,(H2,15,16) |
| InChIKey | VBWHGKQZBKDXTO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|