C11H12F4N2O3 — CID 134677110
ethyl 2-[2-(aminomethyl)-4-fluoro-6-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134677110) has the molecular formula C11H12F4N2O3 and a molecular weight of 296.22 g/mol. Its IUPAC name is ethyl 2-[2-(aminomethyl)-4-fluoro-6-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-(aminomethyl)-4-fluoro-6-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134677110 |
| Molecular Formula | C11H12F4N2O3 |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | ethyl 2-[2-(aminomethyl)-4-fluoro-6-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(F)cc(OC(F)(F)F)nc1CN |
| InChI | InChI=1S/C11H12F4N2O3/c1-2-19-10(18)3-6-7(12)4-9(17-8(6)5-16)20-11(13,14)15/h4H,2-3,5,16H2,1H3 |
| InChIKey | YAZAJKHVYXABCM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |