C11H11F4NO3 — CID 134659708
ethyl 2-[4-fluoro-3-methyl-6-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134659708) has the molecular formula C11H11F4NO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is ethyl 2-[4-fluoro-3-methyl-6-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-fluoro-3-methyl-6-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134659708 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | ethyl 2-[4-fluoro-3-methyl-6-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(OC(F)(F)F)cc(F)c1C |
| InChI | InChI=1S/C11H11F4NO3/c1-3-18-10(17)5-8-6(2)7(12)4-9(16-8)19-11(13,14)15/h4H,3,5H2,1-2H3 |
| InChIKey | ZCCLXVSOTCKUOG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |