C11H10BrF3INO3 — CID 134659026
ethyl 2-[2-(bromomethyl)-4-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetate (PubChem CID 134659026) has the molecular formula C11H10BrF3INO3 and a molecular weight of 468.01 g/mol. Its IUPAC name is ethyl 2-[2-(bromomethyl)-4-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-(bromomethyl)-4-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 134659026 |
| Molecular Formula | C11H10BrF3INO3 |
| Molecular Weight | 468.01 g/mol |
| Exact Mass | 466.88 |
| IUPAC Name | ethyl 2-[2-(bromomethyl)-4-iodo-6-(trifluoromethoxy)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(I)cc(OC(F)(F)F)nc1CBr |
| InChI | InChI=1S/C11H10BrF3INO3/c1-2-19-10(18)3-6-7(16)4-9(17-8(6)5-12)20-11(13,14)15/h4H,2-3,5H2,1H3 |
| InChIKey | GHDVQTWBRVWCPV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.01 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|