C11H10F5NO3 — CID 134665483
ethyl 2-[2-fluoro-3-(fluoromethyl)-6-(trifluoromethoxy)-4-pyridinyl]acetate (PubChem CID 134665483) has the molecular formula C11H10F5NO3 and a molecular weight of 299.20 g/mol. Its IUPAC name is ethyl 2-[2-fluoro-3-(fluoromethyl)-6-(trifluoromethoxy)-4-pyridinyl]acetate.
| Compound Name | ethyl 2-[2-fluoro-3-(fluoromethyl)-6-(trifluoromethoxy)-4-pyridinyl]acetate |
|---|---|
| PubChem CID | 134665483 |
| Molecular Formula | C11H10F5NO3 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | ethyl 2-[2-fluoro-3-(fluoromethyl)-6-(trifluoromethoxy)-4-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC(F)(F)F)nc(F)c1CF |
| InChI | InChI=1S/C11H10F5NO3/c1-2-19-9(18)4-6-3-8(20-11(14,15)16)17-10(13)7(6)5-12/h3H,2,4-5H2,1H3 |
| InChIKey | WDPQPFRPYPNKEA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|