C10H10F4N2O3 — CID 133087422
ethyl 4-amino-3-(fluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 133087422) has the molecular formula C10H10F4N2O3 and a molecular weight of 282.19 g/mol. Its IUPAC name is ethyl 4-amino-3-(fluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | ethyl 4-amino-3-(fluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 133087422 |
| Molecular Formula | C10H10F4N2O3 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | ethyl 4-amino-3-(fluoromethyl)-6-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(OC(F)(F)F)cc(N)c1CF |
| InChI | InChI=1S/C10H10F4N2O3/c1-2-18-9(17)8-5(4-11)6(15)3-7(16-8)19-10(12,13)14/h3H,2,4H2,1H3,(H2,15,16) |
| InChIKey | QDROQOMSZPIDCV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |