C10H8F5NO4 — CID 134660628
ethyl 4-(difluoromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylate (PubChem CID 134660628) has the molecular formula C10H8F5NO4 and a molecular weight of 301.17 g/mol. Its IUPAC name is ethyl 4-(difluoromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylate.
| Compound Name | ethyl 4-(difluoromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134660628 |
| Molecular Formula | C10H8F5NO4 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | ethyl 4-(difluoromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(OC(F)(F)F)cc(C(F)F)c1O |
| InChI | InChI=1S/C10H8F5NO4/c1-2-19-9(18)6-7(17)4(8(11)12)3-5(16-6)20-10(13,14)15/h3,8,17H,2H2,1H3 |
| InChIKey | SJXWJJKCQQYSAX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |