C11H9F5INO3 — CID 134679122
ethyl 2-[3-(difluoromethyl)-4-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetate (PubChem CID 134679122) has the molecular formula C11H9F5INO3 and a molecular weight of 425.09 g/mol. Its IUPAC name is ethyl 2-[3-(difluoromethyl)-4-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-(difluoromethyl)-4-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134679122 |
| Molecular Formula | C11H9F5INO3 |
| Molecular Weight | 425.09 g/mol |
| Exact Mass | 424.95 |
| IUPAC Name | ethyl 2-[3-(difluoromethyl)-4-iodo-6-(trifluoromethoxy)-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(OC(F)(F)F)cc(I)c1C(F)F |
| InChI | InChI=1S/C11H9F5INO3/c1-2-20-8(19)4-6-9(10(12)13)5(17)3-7(18-6)21-11(14,15)16/h3,10H,2,4H2,1H3 |
| InChIKey | BXLRZNUKLQSQTI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.09 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|