C12H15F2NO3 — CID 133100324
ethyl 2-[3-(difluoromethyl)-6-methoxy-4-methyl-2-pyridinyl]acetate (PubChem CID 133100324) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is ethyl 2-[3-(difluoromethyl)-6-methoxy-4-methyl-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[3-(difluoromethyl)-6-methoxy-4-methyl-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 133100324 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl 2-[3-(difluoromethyl)-6-methoxy-4-methyl-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1nc(OC)cc(C)c1C(F)F |
| InChI | InChI=1S/C12H15F2NO3/c1-4-18-10(16)6-8-11(12(13)14)7(2)5-9(15-8)17-3/h5,12H,4,6H2,1-3H3 |
| InChIKey | UTMFRQNNRCAEJA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |