C8H7F6N3O3S — CID 118807327
4-(aminomethyl)-3-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 118807327) has the molecular formula C8H7F6N3O3S and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-(aminomethyl)-3-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | 4-(aminomethyl)-3-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118807327 |
| Molecular Formula | C8H7F6N3O3S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-(aminomethyl)-3-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | NCc1cc(C(F)(F)F)nc(S(N)(=O)=O)c1OC(F)(F)F |
| InChI | InChI=1S/C8H7F6N3O3S/c9-7(10,11)4-1-3(2-15)5(20-8(12,13)14)6(17-4)21(16,18)19/h1H,2,15H2,(H2,16,18,19) |
| InChIKey | SVRWTYHHDNPACY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |