C9H4ClF6NO2 — CID 134676086
4-(chloromethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carbaldehyde (PubChem CID 134676086) has the molecular formula C9H4ClF6NO2 and a molecular weight of 307.58 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carbaldehyde.
| Compound Name | 4-(chloromethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 134676086 |
| Molecular Formula | C9H4ClF6NO2 |
| Molecular Weight | 307.58 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 4-(chloromethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(CCl)cc(C(F)(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H4ClF6NO2/c10-2-4-1-6(8(11,12)13)17-7(5(4)3-18)19-9(14,15)16/h1,3H,2H2 |
| InChIKey | XVDGOACTKVKDEX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|