C9H4F7NO3 — CID 134659573
2-[3-fluoro-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetic acid (PubChem CID 134659573) has the molecular formula C9H4F7NO3 and a molecular weight of 307.12 g/mol. Its IUPAC name is 2-[3-fluoro-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetic acid.
| Compound Name | 2-[3-fluoro-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134659573 |
| Molecular Formula | C9H4F7NO3 |
| Molecular Weight | 307.12 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 2-[3-fluoro-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)(F)F)nc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C9H4F7NO3/c10-6-3(2-5(18)19)1-4(8(11,12)13)17-7(6)20-9(14,15)16/h1H,2H2,(H,18,19) |
| InChIKey | SHBBUDGZLKRAML-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.12 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |