C9H6ClF4NO3 — CID 134665410
2-[5-(chloromethyl)-6-fluoro-2-(trifluoromethoxy)-3-pyridinyl]acetic acid (PubChem CID 134665410) has the molecular formula C9H6ClF4NO3 and a molecular weight of 287.60 g/mol. Its IUPAC name is 2-[5-(chloromethyl)-6-fluoro-2-(trifluoromethoxy)-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-(chloromethyl)-6-fluoro-2-(trifluoromethoxy)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134665410 |
| Molecular Formula | C9H6ClF4NO3 |
| Molecular Weight | 287.60 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | 2-[5-(chloromethyl)-6-fluoro-2-(trifluoromethoxy)-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(CCl)c(F)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H6ClF4NO3/c10-3-5-1-4(2-6(16)17)8(15-7(5)11)18-9(12,13)14/h1H,2-3H2,(H,16,17) |
| InChIKey | WPVYAXMTHIQRLG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|