C8H5ClF3NO4 — CID 134681159
5-(chloromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 134681159) has the molecular formula C8H5ClF3NO4 and a molecular weight of 271.58 g/mol. Its IUPAC name is 5-(chloromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 5-(chloromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134681159 |
| Molecular Formula | C8H5ClF3NO4 |
| Molecular Weight | 271.58 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 5-(chloromethyl)-3-hydroxy-6-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1nc(OC(F)(F)F)c(CCl)cc1O |
| InChI | InChI=1S/C8H5ClF3NO4/c9-2-3-1-4(14)5(7(15)16)13-6(3)17-8(10,11)12/h1,14H,2H2,(H,15,16) |
| InChIKey | CWTYAJNQKVRXRE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|