C10H7F6N3O — CID 134671444
2-[3-(aminomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetonitrile (PubChem CID 134671444) has the molecular formula C10H7F6N3O and a molecular weight of 299.17 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(aminomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134671444 |
| Molecular Formula | C10H7F6N3O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-[3-(aminomethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(C(F)(F)F)nc(OC(F)(F)F)c1CN |
| InChI | InChI=1S/C10H7F6N3O/c11-9(12,13)7-3-5(1-2-17)6(4-18)8(19-7)20-10(14,15)16/h3H,1,4,18H2 |
| InChIKey | AMHIFEXWNLIAOF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |