C9H7F3IN3O — CID 134666816
2-[6-(aminomethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile (PubChem CID 134666816) has the molecular formula C9H7F3IN3O and a molecular weight of 357.07 g/mol. Its IUPAC name is 2-[6-(aminomethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[6-(aminomethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134666816 |
| Molecular Formula | C9H7F3IN3O |
| Molecular Weight | 357.07 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 2-[6-(aminomethyl)-4-iodo-2-(trifluoromethoxy)-3-pyridinyl]acetonitrile |
| SMILES | N#CCc1c(I)cc(CN)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H7F3IN3O/c10-9(11,12)17-8-6(1-2-14)7(13)3-5(4-15)16-8/h3H,1,4,15H2 |
| InChIKey | VWBRFDHTYSMVMW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|