C7H7F4N3O — CID 118833524
6-(aminomethyl)-3-fluoro-2-(trifluoromethoxy)pyridin-4-amine (PubChem CID 118833524) has the molecular formula C7H7F4N3O and a molecular weight of 225.14 g/mol. Its IUPAC name is 6-(aminomethyl)-3-fluoro-2-(trifluoromethoxy)pyridin-4-amine.
| Compound Name | 6-(aminomethyl)-3-fluoro-2-(trifluoromethoxy)pyridin-4-amine |
|---|---|
| PubChem CID | 118833524 |
| Molecular Formula | C7H7F4N3O |
| Molecular Weight | 225.14 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 6-(aminomethyl)-3-fluoro-2-(trifluoromethoxy)pyridin-4-amine |
| SMILES | NCc1cc(N)c(F)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C7H7F4N3O/c8-5-4(13)1-3(2-12)14-6(5)15-7(9,10)11/h1H,2,12H2,(H2,13,14) |
| InChIKey | XNAPYNZAOMCTCS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.14 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |