C9H5F3N4O — CID 118833213
4-amino-5-(cyanomethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile (PubChem CID 118833213) has the molecular formula C9H5F3N4O and a molecular weight of 242.16 g/mol. Its IUPAC name is 4-amino-5-(cyanomethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile.
| Compound Name | 4-amino-5-(cyanomethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 118833213 |
| Molecular Formula | C9H5F3N4O |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 4-amino-5-(cyanomethyl)-6-(trifluoromethoxy)pyridine-2-carbonitrile |
| SMILES | N#CCc1c(N)cc(C#N)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H5F3N4O/c10-9(11,12)17-8-6(1-2-13)7(15)3-5(4-14)16-8/h3H,1H2,(H2,15,16) |
| InChIKey | WKJUSMPERYFYKF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |