C8H4F3N3O2 — CID 118806171
4-amino-6-formyl-5-(trifluoromethoxy)pyridine-2-carbonitrile (PubChem CID 118806171) has the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. Its IUPAC name is 4-amino-6-formyl-5-(trifluoromethoxy)pyridine-2-carbonitrile.
| Compound Name | 4-amino-6-formyl-5-(trifluoromethoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 118806171 |
| Molecular Formula | C8H4F3N3O2 |
| Molecular Weight | 231.13 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4-amino-6-formyl-5-(trifluoromethoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(N)c(OC(F)(F)F)c(C=O)n1 |
| InChI | InChI=1S/C8H4F3N3O2/c9-8(10,11)16-7-5(13)1-4(2-12)14-6(7)3-15/h1,3H,(H2,13,14) |
| InChIKey | BOSUNRMJEWFIAD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.13 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|