C10H8ClF3N2O — CID 133094313
2-[3-(chloromethyl)-6-methyl-2-(trifluoromethoxy)-4-pyridinyl]acetonitrile (PubChem CID 133094313) has the molecular formula C10H8ClF3N2O and a molecular weight of 264.63 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-6-methyl-2-(trifluoromethoxy)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[3-(chloromethyl)-6-methyl-2-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094313 |
| Molecular Formula | C10H8ClF3N2O |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2-[3-(chloromethyl)-6-methyl-2-(trifluoromethoxy)-4-pyridinyl]acetonitrile |
| SMILES | Cc1cc(CC#N)c(CCl)c(OC(F)(F)F)n1 |
| InChI | InChI=1S/C10H8ClF3N2O/c1-6-4-7(2-3-15)8(5-11)9(16-6)17-10(12,13)14/h4H,2,5H2,1H3 |
| InChIKey | JMFKZMQNPANHET-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|