C10H12F2N2O3 — CID 133085156
methyl 4-(aminomethyl)-6-(difluoromethyl)-5-methoxypyridine-2-carboxylate (PubChem CID 133085156) has the molecular formula C10H12F2N2O3 and a molecular weight of 246.21 g/mol. Its IUPAC name is methyl 4-(aminomethyl)-6-(difluoromethyl)-5-methoxypyridine-2-carboxylate.
| Compound Name | methyl 4-(aminomethyl)-6-(difluoromethyl)-5-methoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 133085156 |
| Molecular Formula | C10H12F2N2O3 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | methyl 4-(aminomethyl)-6-(difluoromethyl)-5-methoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(CN)c(OC)c(C(F)F)n1 |
| InChI | InChI=1S/C10H12F2N2O3/c1-16-8-5(4-13)3-6(10(15)17-2)14-7(8)9(11)12/h3,9H,4,13H2,1-2H3 |
| InChIKey | MUDDJHFSRZSUBV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |