About methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate
methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate (PubChem CID 134669232) has the molecular formula C10H11F2NO4
and a molecular weight of 247.20 g/mol. Its IUPAC name is methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate.
Analyze methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate?
The IUPAC name of methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate (CID 134669232) is methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate.
What is the SMILES notation for methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate?
The canonical SMILES for methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate is COC(=O)c1cc(C(F)F)c(OC)c(OC)n1.
What is the InChIKey of methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate?
The InChIKey is LJLRDANMDXUZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO4/c1-15-7-5(8(11)12)4-6(10(14)17-3)13-9(7)16-2/h4,8H,1-3H3.
What are the key properties of methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate?
methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate has a molecular weight of 247.20 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(difluoromethyl)-5,6-dimethoxypyridine-2-carboxylate is sourced from PubChem (CID 134669232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).