methyl 2,3,6-trimethoxypyridine-4-carboxylate

C10H13NO5 — CID 130406819

IUPACmethyl 2,3,6-trimethoxypyridine-4-carboxylate
SMILESCOC(=O)c1cc(OC)nc(OC)c1OC
InChIInChI=1S/C10H13NO5/c1-13-7-5-6(10(12)16-4)8(14-2)9(11-7)15-3/h5H,1-4H3
InChIKeyDYLMNIAWXDAURP-UHFFFAOYSA-N
MW227.22 g/mol
LogP0.89
Rot. Bonds4

About methyl 2,3,6-trimethoxypyridine-4-carboxylate

methyl 2,3,6-trimethoxypyridine-4-carboxylate (PubChem CID 130406819) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 2,3,6-trimethoxypyridine-4-carboxylate.

Molecular Properties

Compound Namemethyl 2,3,6-trimethoxypyridine-4-carboxylate
PubChem CID130406819
Molecular FormulaC10H13NO5
Molecular Weight227.22 g/mol
Exact Mass227.08
IUPAC Namemethyl 2,3,6-trimethoxypyridine-4-carboxylate
SMILESCOC(=O)c1cc(OC)nc(OC)c1OC
InChIInChI=1S/C10H13NO5/c1-13-7-5-6(10(12)16-4)8(14-2)9(11-7)15-3/h5H,1-4H3
InChIKeyDYLMNIAWXDAURP-UHFFFAOYSA-N
XLogP0.89
TPSA66.88 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 2,3,6-trimethoxypyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3,6-trimethoxypyridine-4-carboxylate?
The IUPAC name of methyl 2,3,6-trimethoxypyridine-4-carboxylate (CID 130406819) is methyl 2,3,6-trimethoxypyridine-4-carboxylate.
What is the SMILES notation for methyl 2,3,6-trimethoxypyridine-4-carboxylate?
The canonical SMILES for methyl 2,3,6-trimethoxypyridine-4-carboxylate is COC(=O)c1cc(OC)nc(OC)c1OC.
What is the InChIKey of methyl 2,3,6-trimethoxypyridine-4-carboxylate?
The InChIKey is DYLMNIAWXDAURP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5/c1-13-7-5-6(10(12)16-4)8(14-2)9(11-7)15-3/h5H,1-4H3.
What are the key properties of methyl 2,3,6-trimethoxypyridine-4-carboxylate?
methyl 2,3,6-trimethoxypyridine-4-carboxylate has a molecular weight of 227.22 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3,6-trimethoxypyridine-4-carboxylate is sourced from PubChem (CID 130406819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).