C10H13NO5 — CID 130406819
methyl 2,3,6-trimethoxypyridine-4-carboxylate (PubChem CID 130406819) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 2,3,6-trimethoxypyridine-4-carboxylate.
| Compound Name | methyl 2,3,6-trimethoxypyridine-4-carboxylate |
|---|---|
| PubChem CID | 130406819 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl 2,3,6-trimethoxypyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(OC)nc(OC)c1OC |
| InChI | InChI=1S/C10H13NO5/c1-13-7-5-6(10(12)16-4)8(14-2)9(11-7)15-3/h5H,1-4H3 |
| InChIKey | DYLMNIAWXDAURP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |