C10H11NO5 — CID 86118216
methyl 5-formyl-2,6-dimethoxypyridine-3-carboxylate (PubChem CID 86118216) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is methyl 5-formyl-2,6-dimethoxypyridine-3-carboxylate.
| Compound Name | methyl 5-formyl-2,6-dimethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 86118216 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | methyl 5-formyl-2,6-dimethoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C=O)c(OC)nc1OC |
| InChI | InChI=1S/C10H11NO5/c1-14-8-6(5-12)4-7(10(13)16-3)9(11-8)15-2/h4-5H,1-3H3 |
| InChIKey | YDRDYPIKODOOTA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|