C15H20O8 — CID 176556695
2,5-diformyl-4-methoxycarbonylbenzoic acid;methoxymethane (PubChem CID 176556695) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2,5-diformyl-4-methoxycarbonylbenzoic acid;methoxymethane.
| Compound Name | 2,5-diformyl-4-methoxycarbonylbenzoic acid;methoxymethane |
|---|---|
| PubChem CID | 176556695 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2,5-diformyl-4-methoxycarbonylbenzoic acid;methoxymethane |
| SMILES | COC.COC.COC(=O)c1cc(C=O)c(C(=O)O)cc1C=O |
| InChI | InChI=1S/C11H8O6.2C2H6O/c1-17-11(16)9-3-6(4-12)8(10(14)15)2-7(9)5-13;2*1-3-2/h2-5H,1H3,(H,14,15);2*1-2H3 |
| InChIKey | SBEBHXCSGRPPHX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|