C17H8O6 — CID 145312619
methyl 13-formyl-4,6-dioxo-5-oxatetracyclo[7.6.0.03,7.010,15]pentadeca-1,3(7),8,10(15),11,13-hexaene-12-carboxylate (PubChem CID 145312619) has the molecular formula C17H8O6 and a molecular weight of 308.25 g/mol. Its IUPAC name is methyl 13-formyl-4,6-dioxo-5-oxatetracyclo[7.6.0.03,7.010,15]pentadeca-1,3(7),8,10(15),11,13-hexaene-12-carboxylate.
| Compound Name | methyl 13-formyl-4,6-dioxo-5-oxatetracyclo[7.6.0.03,7.010,15]pentadeca-1,3(7),8,10(15),11,13-hexaene-12-carboxylate |
|---|---|
| PubChem CID | 145312619 |
| Molecular Formula | C17H8O6 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | methyl 13-formyl-4,6-dioxo-5-oxatetracyclo[7.6.0.03,7.010,15]pentadeca-1,3(7),8,10(15),11,13-hexaene-12-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1C=O)c1cc3c(=O)oc(=O)c3cc21 |
| InChI | InChI=1S/C17H8O6/c1-22-15(19)8-3-10-9(2-7(8)6-18)11-4-13-14(5-12(10)11)17(21)23-16(13)20/h2-6H,1H3 |
| InChIKey | ZWDFWUOIYDFGQL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|