C18H8O8 — CID 135191795
methyl 7-formyl-1,3,10-trioxofuro[3,4-b]xanthene-8-carboxylate (PubChem CID 135191795) has the molecular formula C18H8O8 and a molecular weight of 352.25 g/mol. Its IUPAC name is methyl 7-formyl-1,3,10-trioxofuro[3,4-b]xanthene-8-carboxylate.
| Compound Name | methyl 7-formyl-1,3,10-trioxofuro[3,4-b]xanthene-8-carboxylate |
|---|---|
| PubChem CID | 135191795 |
| Molecular Formula | C18H8O8 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | methyl 7-formyl-1,3,10-trioxofuro[3,4-b]xanthene-8-carboxylate |
| SMILES | COC(=O)c1cc2c(=O)c3cc4c(cc3oc2cc1C=O)C(=O)OC4=O |
| InChI | InChI=1S/C18H8O8/c1-24-16(21)8-3-11-13(2-7(8)6-19)25-14-5-10-9(4-12(14)15(11)20)17(22)26-18(10)23/h2-6H,1H3 |
| InChIKey | GVFOQMDRIIMOET-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|