C17H11ClO6 — CID 10688963
dimethyl 7-chloro-9-oxoxanthene-2,3-dicarboxylate (PubChem CID 10688963) has the molecular formula C17H11ClO6 and a molecular weight of 346.72 g/mol. Its IUPAC name is dimethyl 7-chloro-9-oxoxanthene-2,3-dicarboxylate.
| Compound Name | dimethyl 7-chloro-9-oxoxanthene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10688963 |
| Molecular Formula | C17H11ClO6 |
| Molecular Weight | 346.72 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | dimethyl 7-chloro-9-oxoxanthene-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc2oc3ccc(Cl)cc3c(=O)c2cc1C(=O)OC |
| InChI | InChI=1S/C17H11ClO6/c1-22-16(20)9-6-12-14(7-10(9)17(21)23-2)24-13-4-3-8(18)5-11(13)15(12)19/h3-7H,1-2H3 |
| InChIKey | CDKPQEMHVFVITK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|