C16H12ClNO4 — CID 3797554
methyl 7-chloro-2-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 3797554) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is methyl 7-chloro-2-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | methyl 7-chloro-2-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3797554 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | methyl 7-chloro-2-ethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | CCc1nc2oc3ccc(Cl)cc3c(=O)c2cc1C(=O)OC |
| InChI | InChI=1S/C16H12ClNO4/c1-3-12-9(16(20)21-2)7-11-14(19)10-6-8(17)4-5-13(10)22-15(11)18-12/h4-7H,3H2,1-2H3 |
| InChIKey | NFEJUKWSUBMAPP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|