C17H13NO7 — CID 70514076
2-(7-methoxy-3-methoxycarbonyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetic acid (PubChem CID 70514076) has the molecular formula C17H13NO7 and a molecular weight of 343.29 g/mol. Its IUPAC name is 2-(7-methoxy-3-methoxycarbonyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetic acid.
| Compound Name | 2-(7-methoxy-3-methoxycarbonyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetic acid |
|---|---|
| PubChem CID | 70514076 |
| Molecular Formula | C17H13NO7 |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(7-methoxy-3-methoxycarbonyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetic acid |
| SMILES | COC(=O)c1cc2c(=O)c3cc(OC)ccc3oc2nc1CC(=O)O |
| InChI | InChI=1S/C17H13NO7/c1-23-8-3-4-13-10(5-8)15(21)11-6-9(17(22)24-2)12(7-14(19)20)18-16(11)25-13/h3-6H,7H2,1-2H3,(H,19,20) |
| InChIKey | GGNWOYFWJXTFSY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|