C16H16O5 — CID 126598327
ethane-1,2-diol;2-methoxyxanthen-9-one (PubChem CID 126598327) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is ethane-1,2-diol;2-methoxyxanthen-9-one.
| Compound Name | ethane-1,2-diol;2-methoxyxanthen-9-one |
|---|---|
| PubChem CID | 126598327 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | ethane-1,2-diol;2-methoxyxanthen-9-one |
| SMILES | COc1ccc2oc3ccccc3c(=O)c2c1.OCCO |
| InChI | InChI=1S/C14H10O3.C2H6O2/c1-16-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)17-13;3-1-2-4/h2-8H,1H3;3-4H,1-2H2 |
| InChIKey | UYLMZXGEFQRMFS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|