C18H17NO5 — CID 139246796
N-(1-hydroxypropan-2-yl)-6-methoxy-9-oxoxanthene-2-carboxamide (PubChem CID 139246796) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-6-methoxy-9-oxoxanthene-2-carboxamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-6-methoxy-9-oxoxanthene-2-carboxamide |
|---|---|
| PubChem CID | 139246796 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-6-methoxy-9-oxoxanthene-2-carboxamide |
| SMILES | COc1ccc2c(=O)c3cc(C(=O)NC(C)CO)ccc3oc2c1 |
| InChI | InChI=1S/C18H17NO5/c1-10(9-20)19-18(22)11-3-6-15-14(7-11)17(21)13-5-4-12(23-2)8-16(13)24-15/h3-8,10,20H,9H2,1-2H3,(H,19,22) |
| InChIKey | UVHSORWWVKMGSK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|