C22H10O3 — CID 168764753
2-nona-1,3,5,7-tetraynoxyxanthen-9-one (PubChem CID 168764753) has the molecular formula C22H10O3 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-nona-1,3,5,7-tetraynoxyxanthen-9-one.
| Compound Name | 2-nona-1,3,5,7-tetraynoxyxanthen-9-one |
|---|---|
| PubChem CID | 168764753 |
| Molecular Formula | C22H10O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-nona-1,3,5,7-tetraynoxyxanthen-9-one |
| SMILES | CC#CC#CC#CC#COc1ccc2oc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C22H10O3/c1-2-3-4-5-6-7-10-15-24-17-13-14-21-19(16-17)22(23)18-11-8-9-12-20(18)25-21/h8-9,11-14,16H,1H3 |
| InChIKey | YYRPWKGDUZSPPP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|