About 2-methylxanthen-9-one;xanthen-9-one
2-methylxanthen-9-one;xanthen-9-one (PubChem CID 70546954) has the molecular formula C27H18O4
and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-methylxanthen-9-one;xanthen-9-one.
Molecular Properties
| Compound Name | 2-methylxanthen-9-one;xanthen-9-one |
| PubChem CID | 70546954 |
| Molecular Formula | C27H18O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-methylxanthen-9-one;xanthen-9-one |
| SMILES | Cc1ccc2oc3ccccc3c(=O)c2c1.O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C14H10O2.C13H8O2/c1-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)16-13;14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h2-8H,1H3;1-8H |
| InChIKey | GGVNSSQZCQBRGC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylxanthen-9-one;xanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylxanthen-9-one;xanthen-9-one?
The IUPAC name of 2-methylxanthen-9-one;xanthen-9-one (CID 70546954) is 2-methylxanthen-9-one;xanthen-9-one.
What is the SMILES notation for 2-methylxanthen-9-one;xanthen-9-one?
The canonical SMILES for 2-methylxanthen-9-one;xanthen-9-one is Cc1ccc2oc3ccccc3c(=O)c2c1.O=c1c2ccccc2oc2ccccc12.
What is the InChIKey of 2-methylxanthen-9-one;xanthen-9-one?
The InChIKey is GGVNSSQZCQBRGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O2.C13H8O2/c1-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)16-13;14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h2-8H,1H3;1-8H.
What are the key properties of 2-methylxanthen-9-one;xanthen-9-one?
2-methylxanthen-9-one;xanthen-9-one has a molecular weight of 406.44 g/mol, XLogP of 6.20, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylxanthen-9-one;xanthen-9-one is sourced from PubChem (CID 70546954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).