C19H13NO2 — CID 71384416
7-methyl-2-phenylchromeno[2,3-b]pyridin-5-one (PubChem CID 71384416) has the molecular formula C19H13NO2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 7-methyl-2-phenylchromeno[2,3-b]pyridin-5-one.
| Compound Name | 7-methyl-2-phenylchromeno[2,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 71384416 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 7-methyl-2-phenylchromeno[2,3-b]pyridin-5-one |
| SMILES | Cc1ccc2oc3nc(-c4ccccc4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C19H13NO2/c1-12-7-10-17-15(11-12)18(21)14-8-9-16(20-19(14)22-17)13-5-3-2-4-6-13/h2-11H,1H3 |
| InChIKey | XLNGASDJWWHZRI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|