C15H11N3O2 — CID 139229443
6,13-dimethyl-2-oxa-14,15,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-9-one (PubChem CID 139229443) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is 6,13-dimethyl-2-oxa-14,15,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-9-one.
| Compound Name | 6,13-dimethyl-2-oxa-14,15,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-9-one |
|---|---|
| PubChem CID | 139229443 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6,13-dimethyl-2-oxa-14,15,17-triazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),3(8),4,6,11,13,16-heptaen-9-one |
| SMILES | Cc1ccc2oc3nc4[nH]nc(C)c4cc3c(=O)c2c1 |
| InChI | InChI=1S/C15H11N3O2/c1-7-3-4-12-10(5-7)13(19)11-6-9-8(2)17-18-14(9)16-15(11)20-12/h3-6H,1-2H3,(H,16,17,18) |
| InChIKey | JHKZLCFIBGEWKG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|