C28H18N2O4 — CID 177440034
9,24-dimethyl-5,28-dioxa-3,30-diazaheptacyclo[16.12.0.02,15.04,13.06,11.020,29.022,27]triaconta-1(30),2,4(13),6(11),7,9,14,18,20(29),22(27),23,25-dodecaene-12,21-dione (PubChem CID 177440034) has the molecular formula C28H18N2O4 and a molecular weight of 446.46 g/mol. Its IUPAC name is 9,24-dimethyl-5,28-dioxa-3,30-diazaheptacyclo[16.12.0.02,15.04,13.06,11.020,29.022,27]triaconta-1(30),2,4(13),6(11),7,9,14,18,20(29),22(27),23,25-dodecaene-12,21-dione.
| Compound Name | 9,24-dimethyl-5,28-dioxa-3,30-diazaheptacyclo[16.12.0.02,15.04,13.06,11.020,29.022,27]triaconta-1(30),2,4(13),6(11),7,9,14,18,20(29),22(27),23,25-dodecaene-12,21-dione |
|---|---|
| PubChem CID | 177440034 |
| Molecular Formula | C28H18N2O4 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 9,24-dimethyl-5,28-dioxa-3,30-diazaheptacyclo[16.12.0.02,15.04,13.06,11.020,29.022,27]triaconta-1(30),2,4(13),6(11),7,9,14,18,20(29),22(27),23,25-dodecaene-12,21-dione |
| SMILES | Cc1ccc2oc3nc4c(cc3c(=O)c2c1)CCc1cc2c(=O)c3cc(C)ccc3oc2nc1-4 |
| InChI | InChI=1S/C28H18N2O4/c1-13-3-7-21-17(9-13)25(31)19-11-15-5-6-16-12-20-26(32)18-10-14(2)4-8-22(18)34-28(20)30-24(16)23(15)29-27(19)33-21/h3-4,7-12H,5-6H2,1-2H3 |
| InChIKey | STOQGWGEWZUGMS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|