C17H12O2 — CID 10776931
2-methyl-6H-indeno[2,1-b]chromen-11-one (PubChem CID 10776931) has the molecular formula C17H12O2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-methyl-6H-indeno[2,1-b]chromen-11-one.
| Compound Name | 2-methyl-6H-indeno[2,1-b]chromen-11-one |
|---|---|
| PubChem CID | 10776931 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-methyl-6H-indeno[2,1-b]chromen-11-one |
| SMILES | Cc1ccc2oc3c(c(=O)c2c1)-c1ccccc1C3 |
| InChI | InChI=1S/C17H12O2/c1-10-6-7-14-13(8-10)17(18)16-12-5-3-2-4-11(12)9-15(16)19-14/h2-8H,9H2,1H3 |
| InChIKey | MRVLOWHWNIGLAT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |